C26H28F2N4O2 — CID 21073460
6-fluoro-7-[4-[4-(7-fluoronaphthalen-1-yl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-1,8-naphthyridin-2-one (PubChem CID 21073460) has the molecular formula C26H28F2N4O2 and a molecular weight of 466.53 g/mol. Its IUPAC name is 6-fluoro-7-[4-[4-(7-fluoronaphthalen-1-yl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-1,8-naphthyridin-2-one.
| Compound Name | 6-fluoro-7-[4-[4-(7-fluoronaphthalen-1-yl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 21073460 |
| Molecular Formula | C26H28F2N4O2 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | 6-fluoro-7-[4-[4-(7-fluoronaphthalen-1-yl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
| SMILES | O=C1CCc2cc(F)c(OCCCCN3CCN(c4cccc5ccc(F)cc45)CC3)nc2N1 |
| InChI | InChI=1S/C26H28F2N4O2/c27-20-8-6-18-4-3-5-23(21(18)17-20)32-13-11-31(12-14-32)10-1-2-15-34-26-22(28)16-19-7-9-24(33)29-25(19)30-26/h3-6,8,16-17H,1-2,7,9-15H2,(H,29,30,33) |
| InChIKey | RNAHKSUXTAWDPN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|