About 7-[4-[4-(3-fluoronaphthalen-1-yl)piperazin-1-yl]butoxy]-1H-1,8-naphthyridin-2-one
7-[4-[4-(3-fluoronaphthalen-1-yl)piperazin-1-yl]butoxy]-1H-1,8-naphthyridin-2-one (PubChem CID 21073666) has the molecular formula C26H27FN4O2
and a molecular weight of 446.53 g/mol. Its IUPAC name is 7-[4-[4-(3-fluoronaphthalen-1-yl)piperazin-1-yl]butoxy]-1H-1,8-naphthyridin-2-one.
Molecular Properties
| Compound Name | 7-[4-[4-(3-fluoronaphthalen-1-yl)piperazin-1-yl]butoxy]-1H-1,8-naphthyridin-2-one |
| PubChem CID | 21073666 |
| Molecular Formula | C26H27FN4O2 |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 7-[4-[4-(3-fluoronaphthalen-1-yl)piperazin-1-yl]butoxy]-1H-1,8-naphthyridin-2-one |
| SMILES | O=c1ccc2ccc(OCCCCN3CCN(c4cc(F)cc5ccccc45)CC3)nc2[nH]1 |
| InChI | InChI=1S/C26H27FN4O2/c27-21-17-20-5-1-2-6-22(20)23(18-21)31-14-12-30(13-15-31)11-3-4-16-33-25-10-8-19-7-9-24(32)28-26(19)29-25/h1-2,5-10,17-18H,3-4,11-16H2,(H,28,29,32) |
| InChIKey | NQOSHEMNQPCGFQ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-[4-[4-(3-fluoronaphthalen-1-yl)piperazin-1-yl]butoxy]-1H-1,8-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[4-[4-(3-fluoronaphthalen-1-yl)piperazin-1-yl]butoxy]-1H-1,8-naphthyridin-2-one?
The IUPAC name of 7-[4-[4-(3-fluoronaphthalen-1-yl)piperazin-1-yl]butoxy]-1H-1,8-naphthyridin-2-one (CID 21073666) is 7-[4-[4-(3-fluoronaphthalen-1-yl)piperazin-1-yl]butoxy]-1H-1,8-naphthyridin-2-one.
What is the SMILES notation for 7-[4-[4-(3-fluoronaphthalen-1-yl)piperazin-1-yl]butoxy]-1H-1,8-naphthyridin-2-one?
The canonical SMILES for 7-[4-[4-(3-fluoronaphthalen-1-yl)piperazin-1-yl]butoxy]-1H-1,8-naphthyridin-2-one is O=c1ccc2ccc(OCCCCN3CCN(c4cc(F)cc5ccccc45)CC3)nc2[nH]1.
What is the InChIKey of 7-[4-[4-(3-fluoronaphthalen-1-yl)piperazin-1-yl]butoxy]-1H-1,8-naphthyridin-2-one?
The InChIKey is NQOSHEMNQPCGFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H27FN4O2/c27-21-17-20-5-1-2-6-22(20)23(18-21)31-14-12-30(13-15-31)11-3-4-16-33-25-10-8-19-7-9-24(32)28-26(19)29-25/h1-2,5-10,17-18H,3-4,11-16H2,(H,28,29,32).
What are the key properties of 7-[4-[4-(3-fluoronaphthalen-1-yl)piperazin-1-yl]butoxy]-1H-1,8-naphthyridin-2-one?
7-[4-[4-(3-fluoronaphthalen-1-yl)piperazin-1-yl]butoxy]-1H-1,8-naphthyridin-2-one has a molecular weight of 446.53 g/mol, XLogP of 4.20, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[4-[4-(3-fluoronaphthalen-1-yl)piperazin-1-yl]butoxy]-1H-1,8-naphthyridin-2-one is sourced from PubChem (CID 21073666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).