C10H9ClN2O2 — CID 21073909
7-chloro-3,3-dimethyl-1H-1,8-naphthyridine-2,4-dione (PubChem CID 21073909) has the molecular formula C10H9ClN2O2 and a molecular weight of 224.65 g/mol. Its IUPAC name is 7-chloro-3,3-dimethyl-1H-1,8-naphthyridine-2,4-dione.
| Compound Name | 7-chloro-3,3-dimethyl-1H-1,8-naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 21073909 |
| Molecular Formula | C10H9ClN2O2 |
| Molecular Weight | 224.65 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 7-chloro-3,3-dimethyl-1H-1,8-naphthyridine-2,4-dione |
| SMILES | CC1(C)C(=O)Nc2nc(Cl)ccc2C1=O |
| InChI | InChI=1S/C10H9ClN2O2/c1-10(2)7(14)5-3-4-6(11)12-8(5)13-9(10)15/h3-4H,1-2H3,(H,12,13,15) |
| InChIKey | OSFFPIZBRDKSEW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.65 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|