About 7-chloro-5-methyl-1H-1,8-naphthyridin-2-one
7-chloro-5-methyl-1H-1,8-naphthyridin-2-one (PubChem CID 21073917) has the molecular formula C9H7ClN2O
and a molecular weight of 194.62 g/mol. Its IUPAC name is 7-chloro-5-methyl-1H-1,8-naphthyridin-2-one.
Molecular Properties
| Compound Name | 7-chloro-5-methyl-1H-1,8-naphthyridin-2-one |
| PubChem CID | 21073917 |
| Molecular Formula | C9H7ClN2O |
| Molecular Weight | 194.62 g/mol |
| Exact Mass | 194.02 |
| IUPAC Name | 7-chloro-5-methyl-1H-1,8-naphthyridin-2-one |
| SMILES | Cc1cc(Cl)nc2[nH]c(=O)ccc12 |
| InChI | InChI=1S/C9H7ClN2O/c1-5-4-7(10)11-9-6(5)2-3-8(13)12-9/h2-4H,1H3,(H,11,12,13) |
| InChIKey | RRTKZOMFASMWKA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.62 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-5-methyl-1H-1,8-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-5-methyl-1H-1,8-naphthyridin-2-one?
The IUPAC name of 7-chloro-5-methyl-1H-1,8-naphthyridin-2-one (CID 21073917) is 7-chloro-5-methyl-1H-1,8-naphthyridin-2-one.
What is the SMILES notation for 7-chloro-5-methyl-1H-1,8-naphthyridin-2-one?
The canonical SMILES for 7-chloro-5-methyl-1H-1,8-naphthyridin-2-one is Cc1cc(Cl)nc2[nH]c(=O)ccc12.
What is the InChIKey of 7-chloro-5-methyl-1H-1,8-naphthyridin-2-one?
The InChIKey is RRTKZOMFASMWKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClN2O/c1-5-4-7(10)11-9-6(5)2-3-8(13)12-9/h2-4H,1H3,(H,11,12,13).
What are the key properties of 7-chloro-5-methyl-1H-1,8-naphthyridin-2-one?
7-chloro-5-methyl-1H-1,8-naphthyridin-2-one has a molecular weight of 194.62 g/mol, XLogP of 1.88, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-5-methyl-1H-1,8-naphthyridin-2-one is sourced from PubChem (CID 21073917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).