About 8-bromo-2,3-dihydrochromen-4-one
8-bromo-2,3-dihydrochromen-4-one (PubChem CID 21073935) has the molecular formula C9H7BrO2
and a molecular weight of 227.06 g/mol. Its IUPAC name is 8-bromo-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 8-bromo-2,3-dihydrochromen-4-one |
| PubChem CID | 21073935 |
| Molecular Formula | C9H7BrO2 |
| Molecular Weight | 227.06 g/mol |
| Exact Mass | 225.96 |
| IUPAC Name | 8-bromo-2,3-dihydrochromen-4-one |
| SMILES | O=C1CCOc2c(Br)cccc21 |
| InChI | InChI=1S/C9H7BrO2/c10-7-3-1-2-6-8(11)4-5-12-9(6)7/h1-3H,4-5H2 |
| InChIKey | RDFCRUZREBSOGO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.06 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-bromo-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-2,3-dihydrochromen-4-one?
The IUPAC name of 8-bromo-2,3-dihydrochromen-4-one (CID 21073935) is 8-bromo-2,3-dihydrochromen-4-one.
What is the SMILES notation for 8-bromo-2,3-dihydrochromen-4-one?
The canonical SMILES for 8-bromo-2,3-dihydrochromen-4-one is O=C1CCOc2c(Br)cccc21.
What is the InChIKey of 8-bromo-2,3-dihydrochromen-4-one?
The InChIKey is RDFCRUZREBSOGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrO2/c10-7-3-1-2-6-8(11)4-5-12-9(6)7/h1-3H,4-5H2.
What are the key properties of 8-bromo-2,3-dihydrochromen-4-one?
8-bromo-2,3-dihydrochromen-4-one has a molecular weight of 227.06 g/mol, XLogP of 2.41, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-2,3-dihydrochromen-4-one is sourced from PubChem (CID 21073935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).