About 8-chloro-N,N-dimethylquinolin-2-amine
8-chloro-N,N-dimethylquinolin-2-amine (PubChem CID 21073940) has the molecular formula C11H11ClN2
and a molecular weight of 206.68 g/mol. Its IUPAC name is 8-chloro-N,N-dimethylquinolin-2-amine.
Molecular Properties
| Compound Name | 8-chloro-N,N-dimethylquinolin-2-amine |
| PubChem CID | 21073940 |
| Molecular Formula | C11H11ClN2 |
| Molecular Weight | 206.68 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 8-chloro-N,N-dimethylquinolin-2-amine |
| SMILES | CN(C)c1ccc2cccc(Cl)c2n1 |
| InChI | InChI=1S/C11H11ClN2/c1-14(2)10-7-6-8-4-3-5-9(12)11(8)13-10/h3-7H,1-2H3 |
| InChIKey | MWIULHKWHUUIKD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.68 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-chloro-N,N-dimethylquinolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-N,N-dimethylquinolin-2-amine?
The IUPAC name of 8-chloro-N,N-dimethylquinolin-2-amine (CID 21073940) is 8-chloro-N,N-dimethylquinolin-2-amine.
What is the SMILES notation for 8-chloro-N,N-dimethylquinolin-2-amine?
The canonical SMILES for 8-chloro-N,N-dimethylquinolin-2-amine is CN(C)c1ccc2cccc(Cl)c2n1.
What is the InChIKey of 8-chloro-N,N-dimethylquinolin-2-amine?
The InChIKey is MWIULHKWHUUIKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClN2/c1-14(2)10-7-6-8-4-3-5-9(12)11(8)13-10/h3-7H,1-2H3.
What are the key properties of 8-chloro-N,N-dimethylquinolin-2-amine?
8-chloro-N,N-dimethylquinolin-2-amine has a molecular weight of 206.68 g/mol, XLogP of 2.95, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-N,N-dimethylquinolin-2-amine is sourced from PubChem (CID 21073940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).