About 2-[1-(2-fluorophenyl)-6,7-dimethylisoquinolin-3-yl]butan-2-ol
2-[1-(2-fluorophenyl)-6,7-dimethylisoquinolin-3-yl]butan-2-ol (PubChem CID 21074004) has the molecular formula C21H22FNO
and a molecular weight of 323.41 g/mol. Its IUPAC name is 2-[1-(2-fluorophenyl)-6,7-dimethylisoquinolin-3-yl]butan-2-ol.
Molecular Properties
| Compound Name | 2-[1-(2-fluorophenyl)-6,7-dimethylisoquinolin-3-yl]butan-2-ol |
| PubChem CID | 21074004 |
| Molecular Formula | C21H22FNO |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 2-[1-(2-fluorophenyl)-6,7-dimethylisoquinolin-3-yl]butan-2-ol |
| SMILES | CCC(C)(O)c1cc2cc(C)c(C)cc2c(-c2ccccc2F)n1 |
| InChI | InChI=1S/C21H22FNO/c1-5-21(4,24)19-12-15-10-13(2)14(3)11-17(15)20(23-19)16-8-6-7-9-18(16)22/h6-12,24H,5H2,1-4H3 |
| InChIKey | SHFUIJWPSCLZGD-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[1-(2-fluorophenyl)-6,7-dimethylisoquinolin-3-yl]butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(2-fluorophenyl)-6,7-dimethylisoquinolin-3-yl]butan-2-ol?
The IUPAC name of 2-[1-(2-fluorophenyl)-6,7-dimethylisoquinolin-3-yl]butan-2-ol (CID 21074004) is 2-[1-(2-fluorophenyl)-6,7-dimethylisoquinolin-3-yl]butan-2-ol.
What is the SMILES notation for 2-[1-(2-fluorophenyl)-6,7-dimethylisoquinolin-3-yl]butan-2-ol?
The canonical SMILES for 2-[1-(2-fluorophenyl)-6,7-dimethylisoquinolin-3-yl]butan-2-ol is CCC(C)(O)c1cc2cc(C)c(C)cc2c(-c2ccccc2F)n1.
What is the InChIKey of 2-[1-(2-fluorophenyl)-6,7-dimethylisoquinolin-3-yl]butan-2-ol?
The InChIKey is SHFUIJWPSCLZGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22FNO/c1-5-21(4,24)19-12-15-10-13(2)14(3)11-17(15)20(23-19)16-8-6-7-9-18(16)22/h6-12,24H,5H2,1-4H3.
What are the key properties of 2-[1-(2-fluorophenyl)-6,7-dimethylisoquinolin-3-yl]butan-2-ol?
2-[1-(2-fluorophenyl)-6,7-dimethylisoquinolin-3-yl]butan-2-ol has a molecular weight of 323.41 g/mol, XLogP of 5.28, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2-fluorophenyl)-6,7-dimethylisoquinolin-3-yl]butan-2-ol is sourced from PubChem (CID 21074004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).