About 3-benzyl-1,5-dimethyl-6-(3-phenylpropylsulfanyl)pyrimidine-2,4-dione
3-benzyl-1,5-dimethyl-6-(3-phenylpropylsulfanyl)pyrimidine-2,4-dione (PubChem CID 21074010) has the molecular formula C22H24N2O2S
and a molecular weight of 380.51 g/mol. Its IUPAC name is 3-benzyl-1,5-dimethyl-6-(3-phenylpropylsulfanyl)pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 3-benzyl-1,5-dimethyl-6-(3-phenylpropylsulfanyl)pyrimidine-2,4-dione |
| PubChem CID | 21074010 |
| Molecular Formula | C22H24N2O2S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 3-benzyl-1,5-dimethyl-6-(3-phenylpropylsulfanyl)pyrimidine-2,4-dione |
| SMILES | Cc1c(SCCCc2ccccc2)n(C)c(=O)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C22H24N2O2S/c1-17-20(25)24(16-19-12-7-4-8-13-19)22(26)23(2)21(17)27-15-9-14-18-10-5-3-6-11-18/h3-8,10-13H,9,14-16H2,1-2H3 |
| InChIKey | KZMVAJCEXKFBSL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-benzyl-1,5-dimethyl-6-(3-phenylpropylsulfanyl)pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-1,5-dimethyl-6-(3-phenylpropylsulfanyl)pyrimidine-2,4-dione?
The IUPAC name of 3-benzyl-1,5-dimethyl-6-(3-phenylpropylsulfanyl)pyrimidine-2,4-dione (CID 21074010) is 3-benzyl-1,5-dimethyl-6-(3-phenylpropylsulfanyl)pyrimidine-2,4-dione.
What is the SMILES notation for 3-benzyl-1,5-dimethyl-6-(3-phenylpropylsulfanyl)pyrimidine-2,4-dione?
The canonical SMILES for 3-benzyl-1,5-dimethyl-6-(3-phenylpropylsulfanyl)pyrimidine-2,4-dione is Cc1c(SCCCc2ccccc2)n(C)c(=O)n(Cc2ccccc2)c1=O.
What is the InChIKey of 3-benzyl-1,5-dimethyl-6-(3-phenylpropylsulfanyl)pyrimidine-2,4-dione?
The InChIKey is KZMVAJCEXKFBSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O2S/c1-17-20(25)24(16-19-12-7-4-8-13-19)22(26)23(2)21(17)27-15-9-14-18-10-5-3-6-11-18/h3-8,10-13H,9,14-16H2,1-2H3.
What are the key properties of 3-benzyl-1,5-dimethyl-6-(3-phenylpropylsulfanyl)pyrimidine-2,4-dione?
3-benzyl-1,5-dimethyl-6-(3-phenylpropylsulfanyl)pyrimidine-2,4-dione has a molecular weight of 380.51 g/mol, XLogP of 3.63, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-1,5-dimethyl-6-(3-phenylpropylsulfanyl)pyrimidine-2,4-dione is sourced from PubChem (CID 21074010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).