C20H33N3O2 — CID 21074351
[2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl]urea (PubChem CID 21074351) has the molecular formula C20H33N3O2 and a molecular weight of 347.50 g/mol. Its IUPAC name is [2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl]urea.
| Compound Name | [2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 21074351 |
| Molecular Formula | C20H33N3O2 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | [2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl]urea |
| SMILES | CCC1(CC)CC(NC(N)=O)CC(C)(C)N1OC(C)c1ccccc1 |
| InChI | InChI=1S/C20H33N3O2/c1-6-20(7-2)14-17(22-18(21)24)13-19(4,5)23(20)25-15(3)16-11-9-8-10-12-16/h8-12,15,17H,6-7,13-14H2,1-5H3,(H3,21,22,24) |
| InChIKey | LOWCPVZZRIOYKV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |