C22H37N3O2 — CID 21074352
[2,6-diethyl-2,3,6-trimethyl-1-(1-phenylethoxy)piperidin-4-yl]methylurea (PubChem CID 21074352) has the molecular formula C22H37N3O2 and a molecular weight of 375.56 g/mol. Its IUPAC name is [2,6-diethyl-2,3,6-trimethyl-1-(1-phenylethoxy)piperidin-4-yl]methylurea.
| Compound Name | [2,6-diethyl-2,3,6-trimethyl-1-(1-phenylethoxy)piperidin-4-yl]methylurea |
|---|---|
| PubChem CID | 21074352 |
| Molecular Formula | C22H37N3O2 |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.29 |
| IUPAC Name | [2,6-diethyl-2,3,6-trimethyl-1-(1-phenylethoxy)piperidin-4-yl]methylurea |
| SMILES | CCC1(C)CC(CNC(N)=O)C(C)C(C)(CC)N1OC(C)c1ccccc1 |
| InChI | InChI=1S/C22H37N3O2/c1-7-21(5)14-19(15-24-20(23)26)16(3)22(6,8-2)25(21)27-17(4)18-12-10-9-11-13-18/h9-13,16-17,19H,7-8,14-15H2,1-6H3,(H3,23,24,26) |
| InChIKey | MYWMXMPLGZJECX-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |