About 3-ethylheptan-4-amine
3-ethylheptan-4-amine (PubChem CID 21074386) has the molecular formula C9H21N
and a molecular weight of 143.27 g/mol. Its IUPAC name is 3-ethylheptan-4-amine.
Molecular Properties
| Compound Name | 3-ethylheptan-4-amine |
| PubChem CID | 21074386 |
| Molecular Formula | C9H21N |
| Molecular Weight | 143.27 g/mol |
| Exact Mass | 143.17 |
| IUPAC Name | 3-ethylheptan-4-amine |
| SMILES | CCCC(N)C(CC)CC |
| InChI | InChI=1S/C9H21N/c1-4-7-9(10)8(5-2)6-3/h8-9H,4-7,10H2,1-3H3 |
| InChIKey | NSOYUXWFUXFZIN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.27 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethylheptan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylheptan-4-amine?
The IUPAC name of 3-ethylheptan-4-amine (CID 21074386) is 3-ethylheptan-4-amine.
What is the SMILES notation for 3-ethylheptan-4-amine?
The canonical SMILES for 3-ethylheptan-4-amine is CCCC(N)C(CC)CC.
What is the InChIKey of 3-ethylheptan-4-amine?
The InChIKey is NSOYUXWFUXFZIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N/c1-4-7-9(10)8(5-2)6-3/h8-9H,4-7,10H2,1-3H3.
What are the key properties of 3-ethylheptan-4-amine?
3-ethylheptan-4-amine has a molecular weight of 143.27 g/mol, XLogP of 2.55, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylheptan-4-amine is sourced from PubChem (CID 21074386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).