About 9-acetylphenoxazin-3-one
9-acetylphenoxazin-3-one (PubChem CID 21074451) has the molecular formula C14H9NO3
and a molecular weight of 239.23 g/mol. Its IUPAC name is 9-acetylphenoxazin-3-one.
Molecular Properties
| Compound Name | 9-acetylphenoxazin-3-one |
| PubChem CID | 21074451 |
| Molecular Formula | C14H9NO3 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 9-acetylphenoxazin-3-one |
| SMILES | CC(=O)c1cccc2oc3cc(=O)ccc-3nc12 |
| InChI | InChI=1S/C14H9NO3/c1-8(16)10-3-2-4-12-14(10)15-11-6-5-9(17)7-13(11)18-12/h2-7H,1H3 |
| InChIKey | XNNWFLWMHPDNGS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 9-acetylphenoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-acetylphenoxazin-3-one?
The IUPAC name of 9-acetylphenoxazin-3-one (CID 21074451) is 9-acetylphenoxazin-3-one.
What is the SMILES notation for 9-acetylphenoxazin-3-one?
The canonical SMILES for 9-acetylphenoxazin-3-one is CC(=O)c1cccc2oc3cc(=O)ccc-3nc12.
What is the InChIKey of 9-acetylphenoxazin-3-one?
The InChIKey is XNNWFLWMHPDNGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9NO3/c1-8(16)10-3-2-4-12-14(10)15-11-6-5-9(17)7-13(11)18-12/h2-7H,1H3.
What are the key properties of 9-acetylphenoxazin-3-one?
9-acetylphenoxazin-3-one has a molecular weight of 239.23 g/mol, XLogP of 2.50, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-acetylphenoxazin-3-one is sourced from PubChem (CID 21074451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).