About 2,3-dihydro-1,4λ6-benzoxathiine 4,4-dioxide
2,3-dihydro-1,4λ6-benzoxathiine 4,4-dioxide (PubChem CID 21075455) has the molecular formula C8H8O3S
and a molecular weight of 184.22 g/mol. Its IUPAC name is 2,3-dihydro-1,4λ6-benzoxathiine 4,4-dioxide.
Molecular Properties
| Compound Name | 2,3-dihydro-1,4λ6-benzoxathiine 4,4-dioxide |
| PubChem CID | 21075455 |
| Molecular Formula | C8H8O3S |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.02 |
| IUPAC Name | 2,3-dihydro-1,4λ6-benzoxathiine 4,4-dioxide |
| SMILES | O=S1(=O)CCOc2ccccc21 |
| InChI | InChI=1S/C8H8O3S/c9-12(10)6-5-11-7-3-1-2-4-8(7)12/h1-4H,5-6H2 |
| InChIKey | QVOIEXYRCRGOQM-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dihydro-1,4λ6-benzoxathiine 4,4-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1,4λ6-benzoxathiine 4,4-dioxide?
The IUPAC name of 2,3-dihydro-1,4λ6-benzoxathiine 4,4-dioxide (CID 21075455) is 2,3-dihydro-1,4λ6-benzoxathiine 4,4-dioxide.
What is the SMILES notation for 2,3-dihydro-1,4λ6-benzoxathiine 4,4-dioxide?
The canonical SMILES for 2,3-dihydro-1,4λ6-benzoxathiine 4,4-dioxide is O=S1(=O)CCOc2ccccc21.
What is the InChIKey of 2,3-dihydro-1,4λ6-benzoxathiine 4,4-dioxide?
The InChIKey is QVOIEXYRCRGOQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3S/c9-12(10)6-5-11-7-3-1-2-4-8(7)12/h1-4H,5-6H2.
What are the key properties of 2,3-dihydro-1,4λ6-benzoxathiine 4,4-dioxide?
2,3-dihydro-1,4λ6-benzoxathiine 4,4-dioxide has a molecular weight of 184.22 g/mol, XLogP of 0.85, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1,4λ6-benzoxathiine 4,4-dioxide is sourced from PubChem (CID 21075455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).