C25H25F2NO3 — CID 21075708
2-[(7,9-difluoro-2,2,4-trimethyl-1,5-dihydrochromeno[3,4-f]quinolin-5-yl)methyl]prop-2-enyl acetate (PubChem CID 21075708) has the molecular formula C25H25F2NO3 and a molecular weight of 425.48 g/mol. Its IUPAC name is 2-[(7,9-difluoro-2,2,4-trimethyl-1,5-dihydrochromeno[3,4-f]quinolin-5-yl)methyl]prop-2-enyl acetate.
| Compound Name | 2-[(7,9-difluoro-2,2,4-trimethyl-1,5-dihydrochromeno[3,4-f]quinolin-5-yl)methyl]prop-2-enyl acetate |
|---|---|
| PubChem CID | 21075708 |
| Molecular Formula | C25H25F2NO3 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 2-[(7,9-difluoro-2,2,4-trimethyl-1,5-dihydrochromeno[3,4-f]quinolin-5-yl)methyl]prop-2-enyl acetate |
| SMILES | C=C(COC(C)=O)CC1Oc2c(F)cc(F)cc2-c2ccc3c(c21)C(C)=CC(C)(C)N3 |
| InChI | InChI=1S/C25H25F2NO3/c1-13(12-30-15(3)29)8-21-23-17(18-9-16(26)10-19(27)24(18)31-21)6-7-20-22(23)14(2)11-25(4,5)28-20/h6-7,9-11,21,28H,1,8,12H2,2-5H3 |
| InChIKey | QHVOTBWPKPISNM-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|