C16H38O4Si2 — CID 21075959
(2S,3S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]butane-2,3-diol (PubChem CID 21075959) has the molecular formula C16H38O4Si2 and a molecular weight of 350.65 g/mol. Its IUPAC name is (2S,3S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]butane-2,3-diol.
| Compound Name | (2S,3S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]butane-2,3-diol |
|---|---|
| PubChem CID | 21075959 |
| Molecular Formula | C16H38O4Si2 |
| Molecular Weight | 350.65 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | (2S,3S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]butane-2,3-diol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H](O)[C@@H](O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H38O4Si2/c1-15(2,3)21(7,8)19-11-13(17)14(18)12-20-22(9,10)16(4,5)6/h13-14,17-18H,11-12H2,1-10H3/t13-,14-/m0/s1 |
| InChIKey | ZMNUTQHUNQUVDP-KBPBESRZSA-N |
| XLogP | 3.75 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.65 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|