About 1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxylic acid
1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxylic acid (PubChem CID 21076134) has the molecular formula C7H10F3NO2
and a molecular weight of 197.16 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxylic acid |
| PubChem CID | 21076134 |
| Molecular Formula | C7H10F3NO2 |
| Molecular Weight | 197.16 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C7H10F3NO2/c8-7(9,10)4-11-2-1-5(3-11)6(12)13/h5H,1-4H2,(H,12,13) |
| InChIKey | MNFBAEVUUVXHAP-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.16 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxylic acid?
The IUPAC name of 1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxylic acid (CID 21076134) is 1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxylic acid.
What is the SMILES notation for 1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxylic acid?
The canonical SMILES for 1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxylic acid is O=C(O)C1CCN(CC(F)(F)F)C1.
What is the InChIKey of 1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxylic acid?
The InChIKey is MNFBAEVUUVXHAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10F3NO2/c8-7(9,10)4-11-2-1-5(3-11)6(12)13/h5H,1-4H2,(H,12,13).
What are the key properties of 1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxylic acid?
1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxylic acid has a molecular weight of 197.16 g/mol, XLogP of 0.96, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxylic acid is sourced from PubChem (CID 21076134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).