C37H36FNO6 — CID 21076425
11-(2-fluoro-4-methoxyphenyl)-11-(4-morpholin-4-ylphenyl)-4-pentyl-3,5,12-trioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2(7),8(13),9,14,16-hexaen-6-one (PubChem CID 21076425) has the molecular formula C37H36FNO6 and a molecular weight of 609.69 g/mol. Its IUPAC name is 11-(2-fluoro-4-methoxyphenyl)-11-(4-morpholin-4-ylphenyl)-4-pentyl-3,5,12-trioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2(7),8(13),9,14,16-hexaen-6-one.
| Compound Name | 11-(2-fluoro-4-methoxyphenyl)-11-(4-morpholin-4-ylphenyl)-4-pentyl-3,5,12-trioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2(7),8(13),9,14,16-hexaen-6-one |
|---|---|
| PubChem CID | 21076425 |
| Molecular Formula | C37H36FNO6 |
| Molecular Weight | 609.69 g/mol |
| Exact Mass | 609.25 |
| IUPAC Name | 11-(2-fluoro-4-methoxyphenyl)-11-(4-morpholin-4-ylphenyl)-4-pentyl-3,5,12-trioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2(7),8(13),9,14,16-hexaen-6-one |
| SMILES | CCCCCC1OC(=O)c2c3c(c4ccccc4c2O1)OC(c1ccc(N2CCOCC2)cc1)(c1ccc(OC)cc1F)C=C3 |
| InChI | InChI=1S/C37H36FNO6/c1-3-4-5-10-32-43-35-28-9-7-6-8-27(28)34-29(33(35)36(40)44-32)17-18-37(45-34,30-16-15-26(41-2)23-31(30)38)24-11-13-25(14-12-24)39-19-21-42-22-20-39/h6-9,11-18,23,32H,3-5,10,19-22H2,1-2H3 |
| InChIKey | BRNHVGBBTLXYPY-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.69 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|