About 4-O-cyclohexyl 1-O-[(4-fluorophenyl)methyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate
4-O-cyclohexyl 1-O-[(4-fluorophenyl)methyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate (PubChem CID 21076758) has the molecular formula C22H30FNO6
and a molecular weight of 423.48 g/mol. Its IUPAC name is 4-O-cyclohexyl 1-O-[(4-fluorophenyl)methyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate.
Molecular Properties
| Compound Name | 4-O-cyclohexyl 1-O-[(4-fluorophenyl)methyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
| PubChem CID | 21076758 |
| Molecular Formula | C22H30FNO6 |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 4-O-cyclohexyl 1-O-[(4-fluorophenyl)methyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)OC1CCCCC1)C(=O)OCc1ccc(F)cc1 |
| InChI | InChI=1S/C22H30FNO6/c1-22(2,3)30-21(27)24-18(13-19(25)29-17-7-5-4-6-8-17)20(26)28-14-15-9-11-16(23)12-10-15/h9-12,17-18H,4-8,13-14H2,1-3H3,(H,24,27)/t18-/m0/s1 |
| InChIKey | MMKZIKCTJRLFPT-SFHVURJKSA-N |
| XLogP | 4.03 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze 4-O-cyclohexyl 1-O-[(4-fluorophenyl)methyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-cyclohexyl 1-O-[(4-fluorophenyl)methyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate?
The IUPAC name of 4-O-cyclohexyl 1-O-[(4-fluorophenyl)methyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate (CID 21076758) is 4-O-cyclohexyl 1-O-[(4-fluorophenyl)methyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate.
What is the SMILES notation for 4-O-cyclohexyl 1-O-[(4-fluorophenyl)methyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate?
The canonical SMILES for 4-O-cyclohexyl 1-O-[(4-fluorophenyl)methyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate is CC(C)(C)OC(=O)N[C@@H](CC(=O)OC1CCCCC1)C(=O)OCc1ccc(F)cc1.
What is the InChIKey of 4-O-cyclohexyl 1-O-[(4-fluorophenyl)methyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate?
The InChIKey is MMKZIKCTJRLFPT-SFHVURJKSA-N. The full InChI is InChI=1S/C22H30FNO6/c1-22(2,3)30-21(27)24-18(13-19(25)29-17-7-5-4-6-8-17)20(26)28-14-15-9-11-16(23)12-10-15/h9-12,17-18H,4-8,13-14H2,1-3H3,(H,24,27)/t18-/m0/s1.
What are the key properties of 4-O-cyclohexyl 1-O-[(4-fluorophenyl)methyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate?
4-O-cyclohexyl 1-O-[(4-fluorophenyl)methyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate has a molecular weight of 423.48 g/mol, XLogP of 4.03, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-cyclohexyl 1-O-[(4-fluorophenyl)methyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate is sourced from PubChem (CID 21076758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).