C33H33F6N3O4 — CID 21076982
[3,5-bis(trifluoromethyl)phenyl]-[2-[[3-(2-methoxyethoxymethoxy)-4-methylphenyl]methyl]-4-(3-pyridin-3-ylprop-2-ynyl)piperazin-1-yl]methanone (PubChem CID 21076982) has the molecular formula C33H33F6N3O4 and a molecular weight of 649.63 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]-[2-[[3-(2-methoxyethoxymethoxy)-4-methylphenyl]methyl]-4-(3-pyridin-3-ylprop-2-ynyl)piperazin-1-yl]methanone.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]-[2-[[3-(2-methoxyethoxymethoxy)-4-methylphenyl]methyl]-4-(3-pyridin-3-ylprop-2-ynyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 21076982 |
| Molecular Formula | C33H33F6N3O4 |
| Molecular Weight | 649.63 g/mol |
| Exact Mass | 649.24 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]-[2-[[3-(2-methoxyethoxymethoxy)-4-methylphenyl]methyl]-4-(3-pyridin-3-ylprop-2-ynyl)piperazin-1-yl]methanone |
| SMILES | COCCOCOc1cc(CC2CN(CC#Cc3cccnc3)CCN2C(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)ccc1C |
| InChI | InChI=1S/C33H33F6N3O4/c1-23-7-8-25(16-30(23)46-22-45-14-13-44-2)15-29-21-41(10-4-6-24-5-3-9-40-20-24)11-12-42(29)31(43)26-17-27(32(34,35)36)19-28(18-26)33(37,38)39/h3,5,7-9,16-20,29H,10-15,21-22H2,1-2H3 |
| InChIKey | XSUGVAKTAUZOIH-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.63 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|