About N-[2-(3,4-dichloroanilino)-4-(methylamino)pyrimidin-5-yl]butane-1-sulfonamide
N-[2-(3,4-dichloroanilino)-4-(methylamino)pyrimidin-5-yl]butane-1-sulfonamide (PubChem CID 21077438) has the molecular formula C15H19Cl2N5O2S
and a molecular weight of 404.32 g/mol. Its IUPAC name is N-[2-(3,4-dichloroanilino)-4-(methylamino)pyrimidin-5-yl]butane-1-sulfonamide.
Molecular Properties
| Compound Name | N-[2-(3,4-dichloroanilino)-4-(methylamino)pyrimidin-5-yl]butane-1-sulfonamide |
| PubChem CID | 21077438 |
| Molecular Formula | C15H19Cl2N5O2S |
| Molecular Weight | 404.32 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | N-[2-(3,4-dichloroanilino)-4-(methylamino)pyrimidin-5-yl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)Nc1cnc(Nc2ccc(Cl)c(Cl)c2)nc1NC |
| InChI | InChI=1S/C15H19Cl2N5O2S/c1-3-4-7-25(23,24)22-13-9-19-15(21-14(13)18-2)20-10-5-6-11(16)12(17)8-10/h5-6,8-9,22H,3-4,7H2,1-2H3,(H2,18,19,20,21) |
| InChIKey | MODNNPPIORRNPK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.32 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[2-(3,4-dichloroanilino)-4-(methylamino)pyrimidin-5-yl]butane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,4-dichloroanilino)-4-(methylamino)pyrimidin-5-yl]butane-1-sulfonamide?
The IUPAC name of N-[2-(3,4-dichloroanilino)-4-(methylamino)pyrimidin-5-yl]butane-1-sulfonamide (CID 21077438) is N-[2-(3,4-dichloroanilino)-4-(methylamino)pyrimidin-5-yl]butane-1-sulfonamide.
What is the SMILES notation for N-[2-(3,4-dichloroanilino)-4-(methylamino)pyrimidin-5-yl]butane-1-sulfonamide?
The canonical SMILES for N-[2-(3,4-dichloroanilino)-4-(methylamino)pyrimidin-5-yl]butane-1-sulfonamide is CCCCS(=O)(=O)Nc1cnc(Nc2ccc(Cl)c(Cl)c2)nc1NC.
What is the InChIKey of N-[2-(3,4-dichloroanilino)-4-(methylamino)pyrimidin-5-yl]butane-1-sulfonamide?
The InChIKey is MODNNPPIORRNPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19Cl2N5O2S/c1-3-4-7-25(23,24)22-13-9-19-15(21-14(13)18-2)20-10-5-6-11(16)12(17)8-10/h5-6,8-9,22H,3-4,7H2,1-2H3,(H2,18,19,20,21).
What are the key properties of N-[2-(3,4-dichloroanilino)-4-(methylamino)pyrimidin-5-yl]butane-1-sulfonamide?
N-[2-(3,4-dichloroanilino)-4-(methylamino)pyrimidin-5-yl]butane-1-sulfonamide has a molecular weight of 404.32 g/mol, XLogP of 4.11, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,4-dichloroanilino)-4-(methylamino)pyrimidin-5-yl]butane-1-sulfonamide is sourced from PubChem (CID 21077438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).