C28H36FN3O3S — CID 21078463
N-[(2S,3S)-1,1-bis[4-(dimethylamino)phenyl]-1-hydroxy-3-methylpentan-2-yl]-4-fluorobenzenesulfonamide (PubChem CID 21078463) has the molecular formula C28H36FN3O3S and a molecular weight of 513.68 g/mol. Its IUPAC name is N-[(2S,3S)-1,1-bis[4-(dimethylamino)phenyl]-1-hydroxy-3-methylpentan-2-yl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[(2S,3S)-1,1-bis[4-(dimethylamino)phenyl]-1-hydroxy-3-methylpentan-2-yl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 21078463 |
| Molecular Formula | C28H36FN3O3S |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | N-[(2S,3S)-1,1-bis[4-(dimethylamino)phenyl]-1-hydroxy-3-methylpentan-2-yl]-4-fluorobenzenesulfonamide |
| SMILES | CC[C@H](C)[C@H](NS(=O)(=O)c1ccc(F)cc1)C(O)(c1ccc(N(C)C)cc1)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C28H36FN3O3S/c1-7-20(2)27(30-36(34,35)26-18-12-23(29)13-19-26)28(33,21-8-14-24(15-9-21)31(3)4)22-10-16-25(17-11-22)32(5)6/h8-20,27,30,33H,7H2,1-6H3/t20-,27-/m0/s1 |
| InChIKey | IQUVFZKMUUCJSL-DCFHFQCYSA-N |
| XLogP | 4.59 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|