About 4-bromo-2,5-difluoro-N-(1-hydroxy-3-methylpentan-2-yl)benzenesulfonamide
4-bromo-2,5-difluoro-N-(1-hydroxy-3-methylpentan-2-yl)benzenesulfonamide (PubChem CID 21078696) has the molecular formula C12H16BrF2NO3S
and a molecular weight of 372.23 g/mol. Its IUPAC name is 4-bromo-2,5-difluoro-N-(1-hydroxy-3-methylpentan-2-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-bromo-2,5-difluoro-N-(1-hydroxy-3-methylpentan-2-yl)benzenesulfonamide |
| PubChem CID | 21078696 |
| Molecular Formula | C12H16BrF2NO3S |
| Molecular Weight | 372.23 g/mol |
| Exact Mass | 371.00 |
| IUPAC Name | 4-bromo-2,5-difluoro-N-(1-hydroxy-3-methylpentan-2-yl)benzenesulfonamide |
| SMILES | CCC(C)C(CO)NS(=O)(=O)c1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C12H16BrF2NO3S/c1-3-7(2)11(6-17)16-20(18,19)12-5-9(14)8(13)4-10(12)15/h4-5,7,11,16-17H,3,6H2,1-2H3 |
| InChIKey | ZNNSAWMLAHBXJL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.23 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2,5-difluoro-N-(1-hydroxy-3-methylpentan-2-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2,5-difluoro-N-(1-hydroxy-3-methylpentan-2-yl)benzenesulfonamide?
The IUPAC name of 4-bromo-2,5-difluoro-N-(1-hydroxy-3-methylpentan-2-yl)benzenesulfonamide (CID 21078696) is 4-bromo-2,5-difluoro-N-(1-hydroxy-3-methylpentan-2-yl)benzenesulfonamide.
What is the SMILES notation for 4-bromo-2,5-difluoro-N-(1-hydroxy-3-methylpentan-2-yl)benzenesulfonamide?
The canonical SMILES for 4-bromo-2,5-difluoro-N-(1-hydroxy-3-methylpentan-2-yl)benzenesulfonamide is CCC(C)C(CO)NS(=O)(=O)c1cc(F)c(Br)cc1F.
What is the InChIKey of 4-bromo-2,5-difluoro-N-(1-hydroxy-3-methylpentan-2-yl)benzenesulfonamide?
The InChIKey is ZNNSAWMLAHBXJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16BrF2NO3S/c1-3-7(2)11(6-17)16-20(18,19)12-5-9(14)8(13)4-10(12)15/h4-5,7,11,16-17H,3,6H2,1-2H3.
What are the key properties of 4-bromo-2,5-difluoro-N-(1-hydroxy-3-methylpentan-2-yl)benzenesulfonamide?
4-bromo-2,5-difluoro-N-(1-hydroxy-3-methylpentan-2-yl)benzenesulfonamide has a molecular weight of 372.23 g/mol, XLogP of 2.41, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2,5-difluoro-N-(1-hydroxy-3-methylpentan-2-yl)benzenesulfonamide is sourced from PubChem (CID 21078696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).