C19H25N3O3 — CID 21078846
N-[2-(5-benzyl-1,3,4-oxadiazol-2-yl)-3-cyclohexylpropyl]-N-hydroxyformamide (PubChem CID 21078846) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is N-[2-(5-benzyl-1,3,4-oxadiazol-2-yl)-3-cyclohexylpropyl]-N-hydroxyformamide.
| Compound Name | N-[2-(5-benzyl-1,3,4-oxadiazol-2-yl)-3-cyclohexylpropyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 21078846 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N-[2-(5-benzyl-1,3,4-oxadiazol-2-yl)-3-cyclohexylpropyl]-N-hydroxyformamide |
| SMILES | O=CN(O)CC(CC1CCCCC1)c1nnc(Cc2ccccc2)o1 |
| InChI | InChI=1S/C19H25N3O3/c23-14-22(24)13-17(11-15-7-3-1-4-8-15)19-21-20-18(25-19)12-16-9-5-2-6-10-16/h2,5-6,9-10,14-15,17,24H,1,3-4,7-8,11-13H2 |
| InChIKey | QPGBYPFJZKLJGZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|