C15H15BrF3NOS — CID 21079061
1-[4-(trifluoromethyl)phenyl]-2-(2,4,5-trimethyl-1,3-thiazol-3-ium-3-yl)ethanone bromide (PubChem CID 21079061) has the molecular formula C15H15BrF3NOS and a molecular weight of 394.26 g/mol. Its IUPAC name is 1-[4-(trifluoromethyl)phenyl]-2-(2,4,5-trimethyl-1,3-thiazol-3-ium-3-yl)ethanone bromide.
| Compound Name | 1-[4-(trifluoromethyl)phenyl]-2-(2,4,5-trimethyl-1,3-thiazol-3-ium-3-yl)ethanone bromide |
|---|---|
| PubChem CID | 21079061 |
| Molecular Formula | C15H15BrF3NOS |
| Molecular Weight | 394.26 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | 1-[4-(trifluoromethyl)phenyl]-2-(2,4,5-trimethyl-1,3-thiazol-3-ium-3-yl)ethanone bromide |
| SMILES | Cc1sc(C)[n+](CC(=O)c2ccc(C(F)(F)F)cc2)c1C.[Br-] |
| InChI | InChI=1S/C15H15F3NOS.BrH/c1-9-10(2)21-11(3)19(9)8-14(20)12-4-6-13(7-5-12)15(16,17)18;/h4-7H,8H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | ZPMGNMLCFOFVNQ-UHFFFAOYSA-M |
| XLogP | 0.87 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.26 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|