C14H16ClNOS — CID 21079115
1-phenyl-2-(2,4,5-trimethyl-1,3-thiazol-3-ium-3-yl)ethanone chloride (PubChem CID 21079115) has the molecular formula C14H16ClNOS and a molecular weight of 281.81 g/mol. Its IUPAC name is 1-phenyl-2-(2,4,5-trimethyl-1,3-thiazol-3-ium-3-yl)ethanone chloride.
| Compound Name | 1-phenyl-2-(2,4,5-trimethyl-1,3-thiazol-3-ium-3-yl)ethanone chloride |
|---|---|
| PubChem CID | 21079115 |
| Molecular Formula | C14H16ClNOS |
| Molecular Weight | 281.81 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 1-phenyl-2-(2,4,5-trimethyl-1,3-thiazol-3-ium-3-yl)ethanone chloride |
| SMILES | Cc1sc(C)[n+](CC(=O)c2ccccc2)c1C.[Cl-] |
| InChI | InChI=1S/C14H16NOS.ClH/c1-10-11(2)17-12(3)15(10)9-14(16)13-7-5-4-6-8-13;/h4-8H,9H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | HKUKKLFXNPJIQS-UHFFFAOYSA-M |
| XLogP | -0.15 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.81 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|