C12H14NOS2+ — CID 21079164
1-thiophen-2-yl-2-(2,4,5-trimethyl-1,3-thiazol-3-ium-3-yl)ethanone (PubChem CID 21079164) has the molecular formula C12H14NOS2+ and a molecular weight of 252.38 g/mol. Its IUPAC name is 1-thiophen-2-yl-2-(2,4,5-trimethyl-1,3-thiazol-3-ium-3-yl)ethanone.
| Compound Name | 1-thiophen-2-yl-2-(2,4,5-trimethyl-1,3-thiazol-3-ium-3-yl)ethanone |
|---|---|
| PubChem CID | 21079164 |
| Molecular Formula | C12H14NOS2+ |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 1-thiophen-2-yl-2-(2,4,5-trimethyl-1,3-thiazol-3-ium-3-yl)ethanone |
| SMILES | Cc1sc(C)[n+](CC(=O)c2cccs2)c1C |
| InChI | InChI=1S/C12H14NOS2/c1-8-9(2)16-10(3)13(8)7-11(14)12-5-4-6-15-12/h4-6H,7H2,1-3H3/q+1 |
| InChIKey | LOYKXGURMFGTLS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|