C22H17NO6 — CID 21079296
2-[4-(4,9-dimethoxy-1,3-dioxobenzo[f]isoindol-2-yl)phenyl]acetic acid (PubChem CID 21079296) has the molecular formula C22H17NO6 and a molecular weight of 391.38 g/mol. Its IUPAC name is 2-[4-(4,9-dimethoxy-1,3-dioxobenzo[f]isoindol-2-yl)phenyl]acetic acid.
| Compound Name | 2-[4-(4,9-dimethoxy-1,3-dioxobenzo[f]isoindol-2-yl)phenyl]acetic acid |
|---|---|
| PubChem CID | 21079296 |
| Molecular Formula | C22H17NO6 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 2-[4-(4,9-dimethoxy-1,3-dioxobenzo[f]isoindol-2-yl)phenyl]acetic acid |
| SMILES | COc1c2c(c(OC)c3ccccc13)C(=O)N(c1ccc(CC(=O)O)cc1)C2=O |
| InChI | InChI=1S/C22H17NO6/c1-28-19-14-5-3-4-6-15(14)20(29-2)18-17(19)21(26)23(22(18)27)13-9-7-12(8-10-13)11-16(24)25/h3-10H,11H2,1-2H3,(H,24,25) |
| InChIKey | DWHWFPARUZAYDV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|