C10H3F5S — CID 21079868
1,5,6,7,8-pentafluoronaphthalene-2-thiol (PubChem CID 21079868) has the molecular formula C10H3F5S and a molecular weight of 250.19 g/mol. Its IUPAC name is 1,5,6,7,8-pentafluoronaphthalene-2-thiol.
| Compound Name | 1,5,6,7,8-pentafluoronaphthalene-2-thiol |
|---|---|
| PubChem CID | 21079868 |
| Molecular Formula | C10H3F5S |
| Molecular Weight | 250.19 g/mol |
| Exact Mass | 249.99 |
| IUPAC Name | 1,5,6,7,8-pentafluoronaphthalene-2-thiol |
| SMILES | Fc1c(F)c(F)c2c(F)c(S)ccc2c1F |
| InChI | InChI=1S/C10H3F5S/c11-6-3-1-2-4(16)7(12)5(3)8(13)10(15)9(6)14/h1-2,16H |
| InChIKey | UNOAMYNUUUVNNJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.19 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|