About N-(1,3-benzothiazol-2-ylsulfanyl)-N-cyclohexylcyclohexanamine
N-(1,3-benzothiazol-2-ylsulfanyl)-N-cyclohexylcyclohexanamine (PubChem CID 21080) has the molecular formula C19H26N2S2
and a molecular weight of 346.56 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylsulfanyl)-N-cyclohexylcyclohexanamine.
Molecular Properties
| Compound Name | N-(1,3-benzothiazol-2-ylsulfanyl)-N-cyclohexylcyclohexanamine |
| PubChem CID | 21080 |
| Molecular Formula | C19H26N2S2 |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylsulfanyl)-N-cyclohexylcyclohexanamine |
| SMILES | c1ccc2sc(SN(C3CCCCC3)C3CCCCC3)nc2c1 |
| InChI | InChI=1S/C19H26N2S2/c1-3-9-15(10-4-1)21(16-11-5-2-6-12-16)23-19-20-17-13-7-8-14-18(17)22-19/h7-8,13-16H,1-6,9-12H2 |
| InChIKey | CMAUJSNXENPPOF-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(1,3-benzothiazol-2-ylsulfanyl)-N-cyclohexylcyclohexanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-benzothiazol-2-ylsulfanyl)-N-cyclohexylcyclohexanamine?
The IUPAC name of N-(1,3-benzothiazol-2-ylsulfanyl)-N-cyclohexylcyclohexanamine (CID 21080) is N-(1,3-benzothiazol-2-ylsulfanyl)-N-cyclohexylcyclohexanamine.
What is the SMILES notation for N-(1,3-benzothiazol-2-ylsulfanyl)-N-cyclohexylcyclohexanamine?
The canonical SMILES for N-(1,3-benzothiazol-2-ylsulfanyl)-N-cyclohexylcyclohexanamine is c1ccc2sc(SN(C3CCCCC3)C3CCCCC3)nc2c1.
What is the InChIKey of N-(1,3-benzothiazol-2-ylsulfanyl)-N-cyclohexylcyclohexanamine?
The InChIKey is CMAUJSNXENPPOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N2S2/c1-3-9-15(10-4-1)21(16-11-5-2-6-12-16)23-19-20-17-13-7-8-14-18(17)22-19/h7-8,13-16H,1-6,9-12H2.
What are the key properties of N-(1,3-benzothiazol-2-ylsulfanyl)-N-cyclohexylcyclohexanamine?
N-(1,3-benzothiazol-2-ylsulfanyl)-N-cyclohexylcyclohexanamine has a molecular weight of 346.56 g/mol, XLogP of 6.27, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-benzothiazol-2-ylsulfanyl)-N-cyclohexylcyclohexanamine is sourced from PubChem (CID 21080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).