C19H22N4OS2 — CID 2108004
2-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]-4-phenyl-5-thiophen-2-yl-1,2,4-triazole-3-thione (PubChem CID 2108004) has the molecular formula C19H22N4OS2 and a molecular weight of 386.55 g/mol. Its IUPAC name is 2-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]-4-phenyl-5-thiophen-2-yl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]-4-phenyl-5-thiophen-2-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 2108004 |
| Molecular Formula | C19H22N4OS2 |
| Molecular Weight | 386.55 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 2-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]-4-phenyl-5-thiophen-2-yl-1,2,4-triazole-3-thione |
| SMILES | C[C@@H]1CN(Cn2nc(-c3cccs3)n(-c3ccccc3)c2=S)C[C@@H](C)O1 |
| InChI | InChI=1S/C19H22N4OS2/c1-14-11-21(12-15(2)24-14)13-22-19(25)23(16-7-4-3-5-8-16)18(20-22)17-9-6-10-26-17/h3-10,14-15H,11-13H2,1-2H3/t14-,15-/m1/s1 |
| InChIKey | GEDIGRSEOACYJL-HUUCEWRRSA-N |
| XLogP | 4.20 |
| TPSA | 35.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|