About 2-[2-[[2-(3,4-dichloroanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]phenol
2-[2-[[2-(3,4-dichloroanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]phenol (PubChem CID 21080415) has the molecular formula C19H15Cl2F3N4O
and a molecular weight of 443.26 g/mol. Its IUPAC name is 2-[2-[[2-(3,4-dichloroanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]phenol.
Molecular Properties
| Compound Name | 2-[2-[[2-(3,4-dichloroanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]phenol |
| PubChem CID | 21080415 |
| Molecular Formula | C19H15Cl2F3N4O |
| Molecular Weight | 443.26 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | 2-[2-[[2-(3,4-dichloroanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]phenol |
| SMILES | Oc1ccccc1CCNc1nc(Nc2ccc(Cl)c(Cl)c2)ncc1C(F)(F)F |
| InChI | InChI=1S/C19H15Cl2F3N4O/c20-14-6-5-12(9-15(14)21)27-18-26-10-13(19(22,23)24)17(28-18)25-8-7-11-3-1-2-4-16(11)29/h1-6,9-10,29H,7-8H2,(H2,25,26,27,28) |
| InChIKey | JPRDJYWYHQQQOA-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.26 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-[[2-(3,4-dichloroanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[[2-(3,4-dichloroanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]phenol?
The IUPAC name of 2-[2-[[2-(3,4-dichloroanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]phenol (CID 21080415) is 2-[2-[[2-(3,4-dichloroanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]phenol.
What is the SMILES notation for 2-[2-[[2-(3,4-dichloroanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]phenol?
The canonical SMILES for 2-[2-[[2-(3,4-dichloroanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]phenol is Oc1ccccc1CCNc1nc(Nc2ccc(Cl)c(Cl)c2)ncc1C(F)(F)F.
What is the InChIKey of 2-[2-[[2-(3,4-dichloroanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]phenol?
The InChIKey is JPRDJYWYHQQQOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15Cl2F3N4O/c20-14-6-5-12(9-15(14)21)27-18-26-10-13(19(22,23)24)17(28-18)25-8-7-11-3-1-2-4-16(11)29/h1-6,9-10,29H,7-8H2,(H2,25,26,27,28).
What are the key properties of 2-[2-[[2-(3,4-dichloroanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]phenol?
2-[2-[[2-(3,4-dichloroanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]phenol has a molecular weight of 443.26 g/mol, XLogP of 5.91, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[[2-(3,4-dichloroanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]phenol is sourced from PubChem (CID 21080415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).