C10H13ClN4O3 — CID 21081058
4-[(2-chloro-5-nitropyrimidin-4-yl)amino]cyclohexan-1-ol (PubChem CID 21081058) has the molecular formula C10H13ClN4O3 and a molecular weight of 272.69 g/mol. Its IUPAC name is 4-[(2-chloro-5-nitropyrimidin-4-yl)amino]cyclohexan-1-ol.
| Compound Name | 4-[(2-chloro-5-nitropyrimidin-4-yl)amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 21081058 |
| Molecular Formula | C10H13ClN4O3 |
| Molecular Weight | 272.69 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 4-[(2-chloro-5-nitropyrimidin-4-yl)amino]cyclohexan-1-ol |
| SMILES | O=[N+]([O-])c1cnc(Cl)nc1NC1CCC(O)CC1 |
| InChI | InChI=1S/C10H13ClN4O3/c11-10-12-5-8(15(17)18)9(14-10)13-6-1-3-7(16)4-2-6/h5-7,16H,1-4H2,(H,12,13,14) |
| InChIKey | MIFZJJWEFJIEFD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 101.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.69 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|