C16H16Cl2F3N5O — CID 21081184
N-[2-[[2-[(3,4-dichlorophenyl)methylamino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]acetamide (PubChem CID 21081184) has the molecular formula C16H16Cl2F3N5O and a molecular weight of 422.24 g/mol. Its IUPAC name is N-[2-[[2-[(3,4-dichlorophenyl)methylamino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[2-[(3,4-dichlorophenyl)methylamino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 21081184 |
| Molecular Formula | C16H16Cl2F3N5O |
| Molecular Weight | 422.24 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | N-[2-[[2-[(3,4-dichlorophenyl)methylamino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNc1nc(NCc2ccc(Cl)c(Cl)c2)ncc1C(F)(F)F |
| InChI | InChI=1S/C16H16Cl2F3N5O/c1-9(27)22-4-5-23-14-11(16(19,20)21)8-25-15(26-14)24-7-10-2-3-12(17)13(18)6-10/h2-3,6,8H,4-5,7H2,1H3,(H,22,27)(H2,23,24,25,26) |
| InChIKey | VIPNIHQSDFUZHU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.24 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|