C15H21N3O3S2 — CID 21081346
4-butoxy-N-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)benzenesulfonamide (PubChem CID 21081346) has the molecular formula C15H21N3O3S2 and a molecular weight of 355.49 g/mol. Its IUPAC name is 4-butoxy-N-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)benzenesulfonamide.
| Compound Name | 4-butoxy-N-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 21081346 |
| Molecular Formula | C15H21N3O3S2 |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 4-butoxy-N-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)benzenesulfonamide |
| SMILES | CCCCOc1ccc(S(=O)(=O)Nc2nc(C(C)C)ns2)cc1 |
| InChI | InChI=1S/C15H21N3O3S2/c1-4-5-10-21-12-6-8-13(9-7-12)23(19,20)18-15-16-14(11(2)3)17-22-15/h6-9,11H,4-5,10H2,1-3H3,(H,16,17,18) |
| InChIKey | CJRICQAORNGYOS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|