C18H19N3O4S2 — CID 21081369
N-[3-(2-ethoxyethyl)-1,2,4-thiadiazol-5-yl]-4-phenoxybenzenesulfonamide (PubChem CID 21081369) has the molecular formula C18H19N3O4S2 and a molecular weight of 405.50 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-1,2,4-thiadiazol-5-yl]-4-phenoxybenzenesulfonamide.
| Compound Name | N-[3-(2-ethoxyethyl)-1,2,4-thiadiazol-5-yl]-4-phenoxybenzenesulfonamide |
|---|---|
| PubChem CID | 21081369 |
| Molecular Formula | C18H19N3O4S2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-1,2,4-thiadiazol-5-yl]-4-phenoxybenzenesulfonamide |
| SMILES | CCOCCc1nsc(NS(=O)(=O)c2ccc(Oc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C18H19N3O4S2/c1-2-24-13-12-17-19-18(26-20-17)21-27(22,23)16-10-8-15(9-11-16)25-14-6-4-3-5-7-14/h3-11H,2,12-13H2,1H3,(H,19,20,21) |
| InChIKey | UXHHSKOUKAGHTB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|