About N-(3-morpholin-4-yl-1,2,4-thiadiazol-5-yl)-4-phenoxybenzenesulfonamide
N-(3-morpholin-4-yl-1,2,4-thiadiazol-5-yl)-4-phenoxybenzenesulfonamide (PubChem CID 21081393) has the molecular formula C18H18N4O4S2
and a molecular weight of 418.50 g/mol. Its IUPAC name is N-(3-morpholin-4-yl-1,2,4-thiadiazol-5-yl)-4-phenoxybenzenesulfonamide.
Molecular Properties
| Compound Name | N-(3-morpholin-4-yl-1,2,4-thiadiazol-5-yl)-4-phenoxybenzenesulfonamide |
| PubChem CID | 21081393 |
| Molecular Formula | C18H18N4O4S2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | N-(3-morpholin-4-yl-1,2,4-thiadiazol-5-yl)-4-phenoxybenzenesulfonamide |
| SMILES | O=S(=O)(Nc1nc(N2CCOCC2)ns1)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C18H18N4O4S2/c23-28(24,21-18-19-17(20-27-18)22-10-12-25-13-11-22)16-8-6-15(7-9-16)26-14-4-2-1-3-5-14/h1-9H,10-13H2,(H,19,20,21) |
| InChIKey | DOVITWLIGFIVRN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze N-(3-morpholin-4-yl-1,2,4-thiadiazol-5-yl)-4-phenoxybenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-morpholin-4-yl-1,2,4-thiadiazol-5-yl)-4-phenoxybenzenesulfonamide?
The IUPAC name of N-(3-morpholin-4-yl-1,2,4-thiadiazol-5-yl)-4-phenoxybenzenesulfonamide (CID 21081393) is N-(3-morpholin-4-yl-1,2,4-thiadiazol-5-yl)-4-phenoxybenzenesulfonamide.
What is the SMILES notation for N-(3-morpholin-4-yl-1,2,4-thiadiazol-5-yl)-4-phenoxybenzenesulfonamide?
The canonical SMILES for N-(3-morpholin-4-yl-1,2,4-thiadiazol-5-yl)-4-phenoxybenzenesulfonamide is O=S(=O)(Nc1nc(N2CCOCC2)ns1)c1ccc(Oc2ccccc2)cc1.
What is the InChIKey of N-(3-morpholin-4-yl-1,2,4-thiadiazol-5-yl)-4-phenoxybenzenesulfonamide?
The InChIKey is DOVITWLIGFIVRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N4O4S2/c23-28(24,21-18-19-17(20-27-18)22-10-12-25-13-11-22)16-8-6-15(7-9-16)26-14-4-2-1-3-5-14/h1-9H,10-13H2,(H,19,20,21).
What are the key properties of N-(3-morpholin-4-yl-1,2,4-thiadiazol-5-yl)-4-phenoxybenzenesulfonamide?
N-(3-morpholin-4-yl-1,2,4-thiadiazol-5-yl)-4-phenoxybenzenesulfonamide has a molecular weight of 418.50 g/mol, XLogP of 2.97, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-morpholin-4-yl-1,2,4-thiadiazol-5-yl)-4-phenoxybenzenesulfonamide is sourced from PubChem (CID 21081393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).