About N-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-4-phenoxybenzenesulfonamide
N-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-4-phenoxybenzenesulfonamide (PubChem CID 21081398) has the molecular formula C18H19N3O3S2
and a molecular weight of 389.50 g/mol. Its IUPAC name is N-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-4-phenoxybenzenesulfonamide.
Molecular Properties
| Compound Name | N-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-4-phenoxybenzenesulfonamide |
| PubChem CID | 21081398 |
| Molecular Formula | C18H19N3O3S2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | N-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-4-phenoxybenzenesulfonamide |
| SMILES | CC(C)(C)c1nsc(NS(=O)(=O)c2ccc(Oc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C18H19N3O3S2/c1-18(2,3)16-19-17(25-20-16)21-26(22,23)15-11-9-14(10-12-15)24-13-7-5-4-6-8-13/h4-12H,1-3H3,(H,19,20,21) |
| InChIKey | KYOLKVVJYJYASZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-4-phenoxybenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-4-phenoxybenzenesulfonamide?
The IUPAC name of N-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-4-phenoxybenzenesulfonamide (CID 21081398) is N-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-4-phenoxybenzenesulfonamide.
What is the SMILES notation for N-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-4-phenoxybenzenesulfonamide?
The canonical SMILES for N-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-4-phenoxybenzenesulfonamide is CC(C)(C)c1nsc(NS(=O)(=O)c2ccc(Oc3ccccc3)cc2)n1.
What is the InChIKey of N-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-4-phenoxybenzenesulfonamide?
The InChIKey is KYOLKVVJYJYASZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3O3S2/c1-18(2,3)16-19-17(25-20-16)21-26(22,23)15-11-9-14(10-12-15)24-13-7-5-4-6-8-13/h4-12H,1-3H3,(H,19,20,21).
What are the key properties of N-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-4-phenoxybenzenesulfonamide?
N-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-4-phenoxybenzenesulfonamide has a molecular weight of 389.50 g/mol, XLogP of 4.43, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-4-phenoxybenzenesulfonamide is sourced from PubChem (CID 21081398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).