C15H9Cl3FN3O2 — CID 21081505
1-[4-(4-amino-2-fluorophenoxy)-1H-pyrrolo[2,3-b]pyridin-3-yl]-2,2,2-trichloroethanone (PubChem CID 21081505) has the molecular formula C15H9Cl3FN3O2 and a molecular weight of 388.61 g/mol. Its IUPAC name is 1-[4-(4-amino-2-fluorophenoxy)-1H-pyrrolo[2,3-b]pyridin-3-yl]-2,2,2-trichloroethanone.
| Compound Name | 1-[4-(4-amino-2-fluorophenoxy)-1H-pyrrolo[2,3-b]pyridin-3-yl]-2,2,2-trichloroethanone |
|---|---|
| PubChem CID | 21081505 |
| Molecular Formula | C15H9Cl3FN3O2 |
| Molecular Weight | 388.61 g/mol |
| Exact Mass | 386.97 |
| IUPAC Name | 1-[4-(4-amino-2-fluorophenoxy)-1H-pyrrolo[2,3-b]pyridin-3-yl]-2,2,2-trichloroethanone |
| SMILES | Nc1ccc(Oc2ccnc3[nH]cc(C(=O)C(Cl)(Cl)Cl)c23)c(F)c1 |
| InChI | InChI=1S/C15H9Cl3FN3O2/c16-15(17,18)13(23)8-6-22-14-12(8)11(3-4-21-14)24-10-2-1-7(20)5-9(10)19/h1-6H,20H2,(H,21,22) |
| InChIKey | OTAFFCQLEGELIA-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.61 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|