About methyl 2-[(3-carbamoyl-4,5,6-trimethyl-2-pyridinyl)sulfanyl]acetate
methyl 2-[(3-carbamoyl-4,5,6-trimethyl-2-pyridinyl)sulfanyl]acetate (PubChem CID 2108154) has the molecular formula C12H16N2O3S
and a molecular weight of 268.34 g/mol. Its IUPAC name is methyl 2-[(3-carbamoyl-4,5,6-trimethyl-2-pyridinyl)sulfanyl]acetate.
Molecular Properties
| Compound Name | methyl 2-[(3-carbamoyl-4,5,6-trimethyl-2-pyridinyl)sulfanyl]acetate |
| PubChem CID | 2108154 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | methyl 2-[(3-carbamoyl-4,5,6-trimethyl-2-pyridinyl)sulfanyl]acetate |
| SMILES | COC(=O)CSc1nc(C)c(C)c(C)c1C(N)=O |
| InChI | InChI=1S/C12H16N2O3S/c1-6-7(2)10(11(13)16)12(14-8(6)3)18-5-9(15)17-4/h5H2,1-4H3,(H2,13,16) |
| InChIKey | UPCVNKWLEOWVCZ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[(3-carbamoyl-4,5,6-trimethyl-2-pyridinyl)sulfanyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(3-carbamoyl-4,5,6-trimethyl-2-pyridinyl)sulfanyl]acetate?
The IUPAC name of methyl 2-[(3-carbamoyl-4,5,6-trimethyl-2-pyridinyl)sulfanyl]acetate (CID 2108154) is methyl 2-[(3-carbamoyl-4,5,6-trimethyl-2-pyridinyl)sulfanyl]acetate.
What is the SMILES notation for methyl 2-[(3-carbamoyl-4,5,6-trimethyl-2-pyridinyl)sulfanyl]acetate?
The canonical SMILES for methyl 2-[(3-carbamoyl-4,5,6-trimethyl-2-pyridinyl)sulfanyl]acetate is COC(=O)CSc1nc(C)c(C)c(C)c1C(N)=O.
What is the InChIKey of methyl 2-[(3-carbamoyl-4,5,6-trimethyl-2-pyridinyl)sulfanyl]acetate?
The InChIKey is UPCVNKWLEOWVCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O3S/c1-6-7(2)10(11(13)16)12(14-8(6)3)18-5-9(15)17-4/h5H2,1-4H3,(H2,13,16).
What are the key properties of methyl 2-[(3-carbamoyl-4,5,6-trimethyl-2-pyridinyl)sulfanyl]acetate?
methyl 2-[(3-carbamoyl-4,5,6-trimethyl-2-pyridinyl)sulfanyl]acetate has a molecular weight of 268.34 g/mol, XLogP of 1.37, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(3-carbamoyl-4,5,6-trimethyl-2-pyridinyl)sulfanyl]acetate is sourced from PubChem (CID 2108154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).