About N-(3-fluoro-4-{1H-pyrrolo[2,3-b]pyridin-4-yloxy}phenyl)-6-phenylpyridine-2-carboxamide
N-(3-fluoro-4-{1H-pyrrolo[2,3-b]pyridin-4-yloxy}phenyl)-6-phenylpyridine-2-carboxamide (PubChem CID 21081778) has the molecular formula C25H17FN4O2
and a molecular weight of 424.40 g/mol. Its IUPAC name is N-[3-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-yloxy)phenyl]-6-phenylpyridine-2-carboxamide.
Molecular Properties
| Compound Name | N-(3-fluoro-4-{1H-pyrrolo[2,3-b]pyridin-4-yloxy}phenyl)-6-phenylpyridine-2-carboxamide |
| PubChem CID | 21081778 |
| Molecular Formula | C25H17FN4O2 |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | N-[3-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-yloxy)phenyl]-6-phenylpyridine-2-carboxamide |
| SMILES | C1=CC=C(C=C1)C2=NC(=CC=C2)C(=O)NC3=CC(=C(C=C3)OC4=C5C=CNC5=NC=C4)F |
| InChI | InChI=1S/C25H17FN4O2/c26-19-15-17(9-10-23(19)32-22-12-14-28-24-18(22)11-13-27-24)29-25(31)21-8-4-7-20(30-21)16-5-2-1-3-6-16/h1-15H,(H,27,28)(H,29,31) |
| InChIKey | PGLMTHFDBWHAIP-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | 631 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(3-fluoro-4-{1H-pyrrolo[2,3-b]pyridin-4-yloxy}phenyl)-6-phenylpyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-fluoro-4-{1H-pyrrolo[2,3-b]pyridin-4-yloxy}phenyl)-6-phenylpyridine-2-carboxamide?
The IUPAC name of N-(3-fluoro-4-{1H-pyrrolo[2,3-b]pyridin-4-yloxy}phenyl)-6-phenylpyridine-2-carboxamide (CID 21081778) is N-[3-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-yloxy)phenyl]-6-phenylpyridine-2-carboxamide.
What is the SMILES notation for N-(3-fluoro-4-{1H-pyrrolo[2,3-b]pyridin-4-yloxy}phenyl)-6-phenylpyridine-2-carboxamide?
The canonical SMILES for N-(3-fluoro-4-{1H-pyrrolo[2,3-b]pyridin-4-yloxy}phenyl)-6-phenylpyridine-2-carboxamide is C1=CC=C(C=C1)C2=NC(=CC=C2)C(=O)NC3=CC(=C(C=C3)OC4=C5C=CNC5=NC=C4)F.
What is the InChIKey of N-(3-fluoro-4-{1H-pyrrolo[2,3-b]pyridin-4-yloxy}phenyl)-6-phenylpyridine-2-carboxamide?
The InChIKey is PGLMTHFDBWHAIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H17FN4O2/c26-19-15-17(9-10-23(19)32-22-12-14-28-24-18(22)11-13-27-24)29-25(31)21-8-4-7-20(30-21)16-5-2-1-3-6-16/h1-15H,(H,27,28)(H,29,31).
What are the key properties of N-(3-fluoro-4-{1H-pyrrolo[2,3-b]pyridin-4-yloxy}phenyl)-6-phenylpyridine-2-carboxamide?
N-(3-fluoro-4-{1H-pyrrolo[2,3-b]pyridin-4-yloxy}phenyl)-6-phenylpyridine-2-carboxamide has a molecular weight of 424.40 g/mol, XLogP of 4.70, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-fluoro-4-{1H-pyrrolo[2,3-b]pyridin-4-yloxy}phenyl)-6-phenylpyridine-2-carboxamide is sourced from PubChem (CID 21081778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).