C26H28N4O2S — CID 21081933
2-(cyclohexylmethoxy)-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]quinoline-3-carbonitrile (PubChem CID 21081933) has the molecular formula C26H28N4O2S and a molecular weight of 460.60 g/mol. Its IUPAC name is 2-(cyclohexylmethoxy)-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]quinoline-3-carbonitrile.
| Compound Name | 2-(cyclohexylmethoxy)-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 21081933 |
| Molecular Formula | C26H28N4O2S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 2-(cyclohexylmethoxy)-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]quinoline-3-carbonitrile |
| SMILES | N#Cc1c(OCC2CCCCC2)nc2ccccc2c1N1CCN(C(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C26H28N4O2S/c27-17-21-24(29-12-14-30(15-13-29)26(31)23-11-6-16-33-23)20-9-4-5-10-22(20)28-25(21)32-18-19-7-2-1-3-8-19/h4-6,9-11,16,19H,1-3,7-8,12-15,18H2 |
| InChIKey | URWNLVKAZRSTMH-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 69.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |