About 2-(4-chlorophenyl)-2-[5-(3-chlorophenyl)tetrazolo[1,5-a]quinolin-7-yl]acetic acid
2-(4-chlorophenyl)-2-[5-(3-chlorophenyl)tetrazolo[1,5-a]quinolin-7-yl]acetic acid (PubChem CID 21082066) has the molecular formula C23H14Cl2N4O2
and a molecular weight of 449.30 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-[5-(3-chlorophenyl)tetrazolo[1,5-a]quinolin-7-yl]acetic acid.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-2-[5-(3-chlorophenyl)tetrazolo[1,5-a]quinolin-7-yl]acetic acid |
| PubChem CID | 21082066 |
| Molecular Formula | C23H14Cl2N4O2 |
| Molecular Weight | 449.30 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | 2-(4-chlorophenyl)-2-[5-(3-chlorophenyl)tetrazolo[1,5-a]quinolin-7-yl]acetic acid |
| SMILES | O=C(O)C(c1ccc(Cl)cc1)c1ccc2c(c1)c(-c1cccc(Cl)c1)cc1nnnn12 |
| InChI | InChI=1S/C23H14Cl2N4O2/c24-16-7-4-13(5-8-16)22(23(30)31)15-6-9-20-19(11-15)18(12-21-26-27-28-29(20)21)14-2-1-3-17(25)10-14/h1-12,22H,(H,30,31) |
| InChIKey | UYBMMYDBUOGORY-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 80.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.30 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-chlorophenyl)-2-[5-(3-chlorophenyl)tetrazolo[1,5-a]quinolin-7-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-2-[5-(3-chlorophenyl)tetrazolo[1,5-a]quinolin-7-yl]acetic acid?
The IUPAC name of 2-(4-chlorophenyl)-2-[5-(3-chlorophenyl)tetrazolo[1,5-a]quinolin-7-yl]acetic acid (CID 21082066) is 2-(4-chlorophenyl)-2-[5-(3-chlorophenyl)tetrazolo[1,5-a]quinolin-7-yl]acetic acid.
What is the SMILES notation for 2-(4-chlorophenyl)-2-[5-(3-chlorophenyl)tetrazolo[1,5-a]quinolin-7-yl]acetic acid?
The canonical SMILES for 2-(4-chlorophenyl)-2-[5-(3-chlorophenyl)tetrazolo[1,5-a]quinolin-7-yl]acetic acid is O=C(O)C(c1ccc(Cl)cc1)c1ccc2c(c1)c(-c1cccc(Cl)c1)cc1nnnn12.
What is the InChIKey of 2-(4-chlorophenyl)-2-[5-(3-chlorophenyl)tetrazolo[1,5-a]quinolin-7-yl]acetic acid?
The InChIKey is UYBMMYDBUOGORY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H14Cl2N4O2/c24-16-7-4-13(5-8-16)22(23(30)31)15-6-9-20-19(11-15)18(12-21-26-27-28-29(20)21)14-2-1-3-17(25)10-14/h1-12,22H,(H,30,31).
What are the key properties of 2-(4-chlorophenyl)-2-[5-(3-chlorophenyl)tetrazolo[1,5-a]quinolin-7-yl]acetic acid?
2-(4-chlorophenyl)-2-[5-(3-chlorophenyl)tetrazolo[1,5-a]quinolin-7-yl]acetic acid has a molecular weight of 449.30 g/mol, XLogP of 5.47, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-2-[5-(3-chlorophenyl)tetrazolo[1,5-a]quinolin-7-yl]acetic acid is sourced from PubChem (CID 21082066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).