C24H18F9N3O — CID 21082160
1,1,1,3,3,3-hexafluoro-2-[2-methyl-1-[[1-methyl-3-[4-(trifluoromethyl)phenyl]pyrazol-5-yl]methyl]indol-5-yl]propan-2-ol (PubChem CID 21082160) has the molecular formula C24H18F9N3O and a molecular weight of 535.41 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[2-methyl-1-[[1-methyl-3-[4-(trifluoromethyl)phenyl]pyrazol-5-yl]methyl]indol-5-yl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[2-methyl-1-[[1-methyl-3-[4-(trifluoromethyl)phenyl]pyrazol-5-yl]methyl]indol-5-yl]propan-2-ol |
|---|---|
| PubChem CID | 21082160 |
| Molecular Formula | C24H18F9N3O |
| Molecular Weight | 535.41 g/mol |
| Exact Mass | 535.13 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[2-methyl-1-[[1-methyl-3-[4-(trifluoromethyl)phenyl]pyrazol-5-yl]methyl]indol-5-yl]propan-2-ol |
| SMILES | Cc1cc2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc2n1Cc1cc(-c2ccc(C(F)(F)F)cc2)nn1C |
| InChI | InChI=1S/C24H18F9N3O/c1-13-9-15-10-17(21(37,23(28,29)30)24(31,32)33)7-8-20(15)36(13)12-18-11-19(34-35(18)2)14-3-5-16(6-4-14)22(25,26)27/h3-11,37H,12H2,1-2H3 |
| InChIKey | BKKNGTGTODMIAT-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 42.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.41 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |