C23H19F6NO — CID 21082171
1,1,1,3,3,3-hexafluoro-2-[2-methyl-1-(naphthalen-2-ylmethyl)-2,3-dihydroindol-5-yl]propan-2-ol (PubChem CID 21082171) has the molecular formula C23H19F6NO and a molecular weight of 439.40 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[2-methyl-1-(naphthalen-2-ylmethyl)-2,3-dihydroindol-5-yl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[2-methyl-1-(naphthalen-2-ylmethyl)-2,3-dihydroindol-5-yl]propan-2-ol |
|---|---|
| PubChem CID | 21082171 |
| Molecular Formula | C23H19F6NO |
| Molecular Weight | 439.40 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[2-methyl-1-(naphthalen-2-ylmethyl)-2,3-dihydroindol-5-yl]propan-2-ol |
| SMILES | CC1Cc2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc2N1Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H19F6NO/c1-14-10-18-12-19(21(31,22(24,25)26)23(27,28)29)8-9-20(18)30(14)13-15-6-7-16-4-2-3-5-17(16)11-15/h2-9,11-12,14,31H,10,13H2,1H3 |
| InChIKey | CNFPEEOTHVQVHL-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.40 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|