C25H20F9N3O — CID 21082175
2-[1-[[1-ethyl-3-[4-(trifluoromethyl)phenyl]pyrazol-5-yl]methyl]-2-methylindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 21082175) has the molecular formula C25H20F9N3O and a molecular weight of 549.44 g/mol. Its IUPAC name is 2-[1-[[1-ethyl-3-[4-(trifluoromethyl)phenyl]pyrazol-5-yl]methyl]-2-methylindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[1-[[1-ethyl-3-[4-(trifluoromethyl)phenyl]pyrazol-5-yl]methyl]-2-methylindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 21082175 |
| Molecular Formula | C25H20F9N3O |
| Molecular Weight | 549.44 g/mol |
| Exact Mass | 549.15 |
| IUPAC Name | 2-[1-[[1-ethyl-3-[4-(trifluoromethyl)phenyl]pyrazol-5-yl]methyl]-2-methylindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCn1nc(-c2ccc(C(F)(F)F)cc2)cc1Cn1c(C)cc2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C25H20F9N3O/c1-3-37-19(12-20(35-37)15-4-6-17(7-5-15)23(26,27)28)13-36-14(2)10-16-11-18(8-9-21(16)36)22(38,24(29,30)31)25(32,33)34/h4-12,38H,3,13H2,1-2H3 |
| InChIKey | UANYTTHYWMIOSW-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 42.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.44 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |