C25H36N4O4 — CID 21082304
(2R)-2-(cyclopentylmethyl)-N-[(1S)-2,2-dimethyl-1-[5-(phenoxymethyl)-1H-imidazol-2-yl]propyl]-3-[formyl(hydroxy)amino]propanamide (PubChem CID 21082304) has the molecular formula C25H36N4O4 and a molecular weight of 456.59 g/mol. Its IUPAC name is (2R)-2-(cyclopentylmethyl)-N-[(1S)-2,2-dimethyl-1-[5-(phenoxymethyl)-1H-imidazol-2-yl]propyl]-3-[formyl(hydroxy)amino]propanamide.
| Compound Name | (2R)-2-(cyclopentylmethyl)-N-[(1S)-2,2-dimethyl-1-[5-(phenoxymethyl)-1H-imidazol-2-yl]propyl]-3-[formyl(hydroxy)amino]propanamide |
|---|---|
| PubChem CID | 21082304 |
| Molecular Formula | C25H36N4O4 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | (2R)-2-(cyclopentylmethyl)-N-[(1S)-2,2-dimethyl-1-[5-(phenoxymethyl)-1H-imidazol-2-yl]propyl]-3-[formyl(hydroxy)amino]propanamide |
| SMILES | CC(C)(C)[C@H](NC(=O)C(CC1CCCC1)CN(O)C=O)c1ncc(COc2ccccc2)[nH]1 |
| InChI | InChI=1S/C25H36N4O4/c1-25(2,3)22(23-26-14-20(27-23)16-33-21-11-5-4-6-12-21)28-24(31)19(15-29(32)17-30)13-18-9-7-8-10-18/h4-6,11-12,14,17-19,22,32H,7-10,13,15-16H2,1-3H3,(H,26,27)(H,28,31)/t19?,22-/m1/s1 |
| InChIKey | WQPLWYJXQUHGFC-AVKWCDSFSA-N |
| XLogP | 4.24 |
| TPSA | 107.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|