C22H31ClN4O3 — CID 21082311
N-[1-(6-chloro-1H-benzimidazol-2-yl)-2,2-dimethylpropyl]-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanamide (PubChem CID 21082311) has the molecular formula C22H31ClN4O3 and a molecular weight of 434.97 g/mol. Its IUPAC name is N-[1-(6-chloro-1H-benzimidazol-2-yl)-2,2-dimethylpropyl]-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanamide.
| Compound Name | N-[1-(6-chloro-1H-benzimidazol-2-yl)-2,2-dimethylpropyl]-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanamide |
|---|---|
| PubChem CID | 21082311 |
| Molecular Formula | C22H31ClN4O3 |
| Molecular Weight | 434.97 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | N-[1-(6-chloro-1H-benzimidazol-2-yl)-2,2-dimethylpropyl]-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanamide |
| SMILES | CC(C)(C)C(NC(=O)C(CC1CCCC1)CN(O)C=O)c1nc2ccc(Cl)cc2[nH]1 |
| InChI | InChI=1S/C22H31ClN4O3/c1-22(2,3)19(20-24-17-9-8-16(23)11-18(17)25-20)26-21(29)15(12-27(30)13-28)10-14-6-4-5-7-14/h8-9,11,13-15,19,30H,4-7,10,12H2,1-3H3,(H,24,25)(H,26,29) |
| InChIKey | FCSXVRYIKKEIRG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.97 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|