C17H19NO3S — CID 21082355
5-[[(E)-ethylideneamino]oxy-(4-propylphenyl)methyl]thiophene-2-carboxylic acid (PubChem CID 21082355) has the molecular formula C17H19NO3S and a molecular weight of 317.41 g/mol. Its IUPAC name is 5-[[(E)-ethylideneamino]oxy-(4-propylphenyl)methyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[[(E)-ethylideneamino]oxy-(4-propylphenyl)methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 21082355 |
| Molecular Formula | C17H19NO3S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 5-[[(E)-ethylideneamino]oxy-(4-propylphenyl)methyl]thiophene-2-carboxylic acid |
| SMILES | C/C=N/OC(c1ccc(CCC)cc1)c1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C17H19NO3S/c1-3-5-12-6-8-13(9-7-12)16(21-18-4-2)14-10-11-15(22-14)17(19)20/h4,6-11,16H,3,5H2,1-2H3,(H,19,20)/b18-4+ |
| InChIKey | JKPOTGNCQGIMEW-JJPRUIFNSA-N |
| XLogP | 4.51 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|