C27H27NO7S2 — CID 21082457
1-[4-[2-(2,4-dimethoxy-5-thiophen-2-ylphenyl)prop-2-enoyl]phenyl]sulfonylpiperidine-2-carboxylic acid (PubChem CID 21082457) has the molecular formula C27H27NO7S2 and a molecular weight of 541.65 g/mol. Its IUPAC name is 1-[4-[2-(2,4-dimethoxy-5-thiophen-2-ylphenyl)prop-2-enoyl]phenyl]sulfonylpiperidine-2-carboxylic acid.
| Compound Name | 1-[4-[2-(2,4-dimethoxy-5-thiophen-2-ylphenyl)prop-2-enoyl]phenyl]sulfonylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 21082457 |
| Molecular Formula | C27H27NO7S2 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.12 |
| IUPAC Name | 1-[4-[2-(2,4-dimethoxy-5-thiophen-2-ylphenyl)prop-2-enoyl]phenyl]sulfonylpiperidine-2-carboxylic acid |
| SMILES | C=C(C(=O)c1ccc(S(=O)(=O)N2CCCCC2C(=O)O)cc1)c1cc(-c2cccs2)c(OC)cc1OC |
| InChI | InChI=1S/C27H27NO7S2/c1-17(20-15-21(25-8-6-14-36-25)24(35-3)16-23(20)34-2)26(29)18-9-11-19(12-10-18)37(32,33)28-13-5-4-7-22(28)27(30)31/h6,8-12,14-16,22H,1,4-5,7,13H2,2-3H3,(H,30,31) |
| InChIKey | AFSQGLZOCJSEIW-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|