C9H10ClN — CID 21082819
4-chloro-2,3,5,6-tetrahydroquinoline (PubChem CID 21082819) has the molecular formula C9H10ClN and a molecular weight of 167.64 g/mol. Its IUPAC name is 4-chloro-2,3,5,6-tetrahydroquinoline.
| Compound Name | 4-chloro-2,3,5,6-tetrahydroquinoline |
|---|---|
| PubChem CID | 21082819 |
| Molecular Formula | C9H10ClN |
| Molecular Weight | 167.64 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | 4-chloro-2,3,5,6-tetrahydroquinoline |
| SMILES | ClC1=C2CCC=CC2=NCC1 |
| InChI | InChI=1S/C9H10ClN/c10-8-5-6-11-9-4-2-1-3-7(8)9/h2,4H,1,3,5-6H2 |
| InChIKey | OCKXSLLSLGPKKX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.64 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |